C31H35N5O4 — CID 6195689
(4E)-4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-1-(3-imidazol-1-ylpropyl)-5-(4-pentoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 6195689) has the molecular formula C31H35N5O4 and a molecular weight of 541.65 g/mol. Its IUPAC name is (4E)-4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-1-(3-imidazol-1-ylpropyl)-5-(4-pentoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-1-(3-imidazol-1-ylpropyl)-5-(4-pentoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6195689 |
| Molecular Formula | C31H35N5O4 |
| Molecular Weight | 541.65 g/mol |
| Exact Mass | 541.27 |
| IUPAC Name | (4E)-4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-1-(3-imidazol-1-ylpropyl)-5-(4-pentoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | CCCCCOc1ccc(C2/C(=C(\O)c3nc4c(C)cccn4c3C)C(=O)C(=O)N2CCCn2ccnc2)cc1 |
| InChI | InChI=1S/C31H35N5O4/c1-4-5-6-19-40-24-12-10-23(11-13-24)27-25(28(37)26-22(3)35-16-7-9-21(2)30(35)33-26)29(38)31(39)36(27)17-8-15-34-18-14-32-20-34/h7,9-14,16,18,20,27,37H,4-6,8,15,17,19H2,1-3H3/b28-25+ |
| InChIKey | SUHGSZRLXVUAFJ-AZPGRJICSA-N |
| XLogP | 5.23 |
| TPSA | 101.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.65 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|