C34H37N3O4 — CID 4704452
4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-5-(4-hexoxyphenyl)-1-(2-phenylethyl)pyrrolidine-2,3-dione (PubChem CID 4704452) has the molecular formula C34H37N3O4 and a molecular weight of 551.69 g/mol. Its IUPAC name is 4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-5-(4-hexoxyphenyl)-1-(2-phenylethyl)pyrrolidine-2,3-dione.
| Compound Name | 4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-5-(4-hexoxyphenyl)-1-(2-phenylethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 4704452 |
| Molecular Formula | C34H37N3O4 |
| Molecular Weight | 551.69 g/mol |
| Exact Mass | 551.28 |
| IUPAC Name | 4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-5-(4-hexoxyphenyl)-1-(2-phenylethyl)pyrrolidine-2,3-dione |
| SMILES | CCCCCCOc1ccc(C2C(=C(O)c3nc4c(C)cccn4c3C)C(=O)C(=O)N2CCc2ccccc2)cc1 |
| InChI | InChI=1S/C34H37N3O4/c1-4-5-6-10-22-41-27-17-15-26(16-18-27)30-28(31(38)29-24(3)36-20-11-12-23(2)33(36)35-29)32(39)34(40)37(30)21-19-25-13-8-7-9-14-25/h7-9,11-18,20,30,38H,4-6,10,19,21-22H2,1-3H3 |
| InChIKey | LKGDTSXYAIAOBR-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.69 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|