C28H24ClN3O3 — CID 6195763
(4E)-5-(4-chlorophenyl)-4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-1-(2-phenylethyl)pyrrolidine-2,3-dione (PubChem CID 6195763) has the molecular formula C28H24ClN3O3 and a molecular weight of 485.97 g/mol. Its IUPAC name is (4E)-5-(4-chlorophenyl)-4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-1-(2-phenylethyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-5-(4-chlorophenyl)-4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-1-(2-phenylethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6195763 |
| Molecular Formula | C28H24ClN3O3 |
| Molecular Weight | 485.97 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | (4E)-5-(4-chlorophenyl)-4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-1-(2-phenylethyl)pyrrolidine-2,3-dione |
| SMILES | Cc1cccn2c(C)c(/C(O)=C3\C(=O)C(=O)N(CCc4ccccc4)C3c3ccc(Cl)cc3)nc12 |
| InChI | InChI=1S/C28H24ClN3O3/c1-17-7-6-15-31-18(2)23(30-27(17)31)25(33)22-24(20-10-12-21(29)13-11-20)32(28(35)26(22)34)16-14-19-8-4-3-5-9-19/h3-13,15,24,33H,14,16H2,1-2H3/b25-22+ |
| InChIKey | GUWJCRZVPLNFDK-YYDJUVGSSA-N |
| XLogP | 5.27 |
| TPSA | 74.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.97 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|