C29H31N5O6 — CID 4704319
4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-1-(3-imidazol-1-ylpropyl)-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 4704319) has the molecular formula C29H31N5O6 and a molecular weight of 545.60 g/mol. Its IUPAC name is 4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-1-(3-imidazol-1-ylpropyl)-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | 4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-1-(3-imidazol-1-ylpropyl)-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 4704319 |
| Molecular Formula | C29H31N5O6 |
| Molecular Weight | 545.60 g/mol |
| Exact Mass | 545.23 |
| IUPAC Name | 4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-1-(3-imidazol-1-ylpropyl)-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | COc1cc(C2C(=C(O)c3nc4c(C)cccn4c3C)C(=O)C(=O)N2CCCn2ccnc2)cc(OC)c1OC |
| InChI | InChI=1S/C29H31N5O6/c1-17-8-6-11-33-18(2)23(31-28(17)33)25(35)22-24(19-14-20(38-3)27(40-5)21(15-19)39-4)34(29(37)26(22)36)12-7-10-32-13-9-30-16-32/h6,8-9,11,13-16,24,35H,7,10,12H2,1-5H3 |
| InChIKey | JQTRBXPFYGHMOE-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.60 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|