C34H35N3O7 — CID 4699111
4-[hydroxy-[4-[(2-methylphenyl)methoxy]phenyl]methylidene]-1-(3-imidazol-1-ylpropyl)-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 4699111) has the molecular formula C34H35N3O7 and a molecular weight of 597.67 g/mol. Its IUPAC name is 4-[hydroxy-[4-[(2-methylphenyl)methoxy]phenyl]methylidene]-1-(3-imidazol-1-ylpropyl)-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | 4-[hydroxy-[4-[(2-methylphenyl)methoxy]phenyl]methylidene]-1-(3-imidazol-1-ylpropyl)-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 4699111 |
| Molecular Formula | C34H35N3O7 |
| Molecular Weight | 597.67 g/mol |
| Exact Mass | 597.25 |
| IUPAC Name | 4-[hydroxy-[4-[(2-methylphenyl)methoxy]phenyl]methylidene]-1-(3-imidazol-1-ylpropyl)-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | COc1cc(C2C(=C(O)c3ccc(OCc4ccccc4C)cc3)C(=O)C(=O)N2CCCn2ccnc2)cc(OC)c1OC |
| InChI | InChI=1S/C34H35N3O7/c1-22-8-5-6-9-24(22)20-44-26-12-10-23(11-13-26)31(38)29-30(25-18-27(41-2)33(43-4)28(19-25)42-3)37(34(40)32(29)39)16-7-15-36-17-14-35-21-36/h5-6,8-14,17-19,21,30,38H,7,15-16,20H2,1-4H3 |
| InChIKey | WRJRZKRTDKNRBZ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 112.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.67 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|