C32H31N3O6 — CID 98314739
(4E,5R)-5-(4-hydroxy-3-methoxyphenyl)-4-[hydroxy-[4-[(2-methylphenyl)methoxy]phenyl]methylidene]-1-(3-imidazol-1-ylpropyl)pyrrolidine-2,3-dione (PubChem CID 98314739) has the molecular formula C32H31N3O6 and a molecular weight of 553.62 g/mol. Its IUPAC name is (4E,5R)-5-(4-hydroxy-3-methoxyphenyl)-4-[hydroxy-[4-[(2-methylphenyl)methoxy]phenyl]methylidene]-1-(3-imidazol-1-ylpropyl)pyrrolidine-2,3-dione.
| Compound Name | (4E,5R)-5-(4-hydroxy-3-methoxyphenyl)-4-[hydroxy-[4-[(2-methylphenyl)methoxy]phenyl]methylidene]-1-(3-imidazol-1-ylpropyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 98314739 |
| Molecular Formula | C32H31N3O6 |
| Molecular Weight | 553.62 g/mol |
| Exact Mass | 553.22 |
| IUPAC Name | (4E,5R)-5-(4-hydroxy-3-methoxyphenyl)-4-[hydroxy-[4-[(2-methylphenyl)methoxy]phenyl]methylidene]-1-(3-imidazol-1-ylpropyl)pyrrolidine-2,3-dione |
| SMILES | COc1cc([C@@H]2/C(=C(\O)c3ccc(OCc4ccccc4C)cc3)C(=O)C(=O)N2CCCn2ccnc2)ccc1O |
| InChI | InChI=1S/C32H31N3O6/c1-21-6-3-4-7-24(21)19-41-25-11-8-22(9-12-25)30(37)28-29(23-10-13-26(36)27(18-23)40-2)35(32(39)31(28)38)16-5-15-34-17-14-33-20-34/h3-4,6-14,17-18,20,29,36-37H,5,15-16,19H2,1-2H3/b30-28+/t29-/m1/s1 |
| InChIKey | SCGAYXIVCDDQSU-WGGXKBPPSA-N |
| XLogP | 5.00 |
| TPSA | 114.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.62 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|