C30H38N4O4 — CID 6195747
(4E)-1-[3-(diethylamino)propyl]-4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-5-(3-propoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 6195747) has the molecular formula C30H38N4O4 and a molecular weight of 518.66 g/mol. Its IUPAC name is (4E)-1-[3-(diethylamino)propyl]-4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-5-(3-propoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-[3-(diethylamino)propyl]-4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-5-(3-propoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6195747 |
| Molecular Formula | C30H38N4O4 |
| Molecular Weight | 518.66 g/mol |
| Exact Mass | 518.29 |
| IUPAC Name | (4E)-1-[3-(diethylamino)propyl]-4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-5-(3-propoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | CCCOc1cccc(C2/C(=C(\O)c3nc4c(C)cccn4c3C)C(=O)C(=O)N2CCCN(CC)CC)c1 |
| InChI | InChI=1S/C30H38N4O4/c1-6-18-38-23-14-9-13-22(19-23)26-24(28(36)30(37)34(26)17-11-15-32(7-2)8-3)27(35)25-21(5)33-16-10-12-20(4)29(33)31-25/h9-10,12-14,16,19,26,35H,6-8,11,15,17-18H2,1-5H3/b27-24+ |
| InChIKey | JIHYUPXEUCQWOJ-SOYKGTTHSA-N |
| XLogP | 4.89 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.66 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|