C24H23NO2 — CID 134958952
(1S,4R,5R,6S)-1'-benzyl-6-(2-methylphenyl)spiro[bicyclo[2.2.1]hept-2-ene-5,4'-pyrrolidine]-2',3'-dione (PubChem CID 134958952) has the molecular formula C24H23NO2 and a molecular weight of 357.45 g/mol. Its IUPAC name is (1S,4R,5R,6S)-1'-benzyl-6-(2-methylphenyl)spiro[bicyclo[2.2.1]hept-2-ene-5,4'-pyrrolidine]-2',3'-dione.
| Compound Name | (1S,4R,5R,6S)-1'-benzyl-6-(2-methylphenyl)spiro[bicyclo[2.2.1]hept-2-ene-5,4'-pyrrolidine]-2',3'-dione |
|---|---|
| PubChem CID | 134958952 |
| Molecular Formula | C24H23NO2 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | (1S,4R,5R,6S)-1'-benzyl-6-(2-methylphenyl)spiro[bicyclo[2.2.1]hept-2-ene-5,4'-pyrrolidine]-2',3'-dione |
| SMILES | Cc1ccccc1[C@@H]1[C@@H]2C=C[C@@H](C2)[C@]12CN(Cc1ccccc1)C(=O)C2=O |
| InChI | InChI=1S/C24H23NO2/c1-16-7-5-6-10-20(16)21-18-11-12-19(13-18)24(21)15-25(23(27)22(24)26)14-17-8-3-2-4-9-17/h2-12,18-19,21H,13-15H2,1H3/t18-,19+,21+,24-/m1/s1 |
| InChIKey | WUZMZWTXHOKSNL-RLIDHQHUSA-N |
| XLogP | 3.88 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|