C32H28N2O3 — CID 177394286
(1R,2S,3S)-6-benzyl-1-naphthalen-1-yl-4,5-dioxo-N-[(1S)-1-phenylethyl]-6-azaspiro[2.4]heptane-2-carboxamide (PubChem CID 177394286) has the molecular formula C32H28N2O3 and a molecular weight of 488.59 g/mol. Its IUPAC name is (1R,2S,3S)-6-benzyl-1-naphthalen-1-yl-4,5-dioxo-N-[(1S)-1-phenylethyl]-6-azaspiro[2.4]heptane-2-carboxamide.
| Compound Name | (1R,2S,3S)-6-benzyl-1-naphthalen-1-yl-4,5-dioxo-N-[(1S)-1-phenylethyl]-6-azaspiro[2.4]heptane-2-carboxamide |
|---|---|
| PubChem CID | 177394286 |
| Molecular Formula | C32H28N2O3 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | (1R,2S,3S)-6-benzyl-1-naphthalen-1-yl-4,5-dioxo-N-[(1S)-1-phenylethyl]-6-azaspiro[2.4]heptane-2-carboxamide |
| SMILES | C[C@H](NC(=O)[C@H]1[C@H](c2cccc3ccccc23)[C@@]12CN(Cc1ccccc1)C(=O)C2=O)c1ccccc1 |
| InChI | InChI=1S/C32H28N2O3/c1-21(23-13-6-3-7-14-23)33-30(36)28-27(26-18-10-16-24-15-8-9-17-25(24)26)32(28)20-34(31(37)29(32)35)19-22-11-4-2-5-12-22/h2-18,21,27-28H,19-20H2,1H3,(H,33,36)/t21-,27-,28+,32-/m0/s1 |
| InChIKey | UNCPROYWJKWLSB-CBSKOZNESA-N |
| XLogP | 5.03 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|