C29H37N3O5 — CID 10029243
(1-benzyl-4,4-dimethyl-2-oxopyrrolidin-3-yl) N-[(3S)-1,2-dioxo-1-[[(1R)-1-phenylethyl]amino]heptan-3-yl]carbamate (PubChem CID 10029243) has the molecular formula C29H37N3O5 and a molecular weight of 507.63 g/mol. Its IUPAC name is (1-benzyl-4,4-dimethyl-2-oxopyrrolidin-3-yl) N-[(3S)-1,2-dioxo-1-[[(1R)-1-phenylethyl]amino]heptan-3-yl]carbamate.
| Compound Name | (1-benzyl-4,4-dimethyl-2-oxopyrrolidin-3-yl) N-[(3S)-1,2-dioxo-1-[[(1R)-1-phenylethyl]amino]heptan-3-yl]carbamate |
|---|---|
| PubChem CID | 10029243 |
| Molecular Formula | C29H37N3O5 |
| Molecular Weight | 507.63 g/mol |
| Exact Mass | 507.27 |
| IUPAC Name | (1-benzyl-4,4-dimethyl-2-oxopyrrolidin-3-yl) N-[(3S)-1,2-dioxo-1-[[(1R)-1-phenylethyl]amino]heptan-3-yl]carbamate |
| SMILES | CCCC[C@H](NC(=O)OC1C(=O)N(Cc2ccccc2)CC1(C)C)C(=O)C(=O)N[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C29H37N3O5/c1-5-6-17-23(24(33)26(34)30-20(2)22-15-11-8-12-16-22)31-28(36)37-25-27(35)32(19-29(25,3)4)18-21-13-9-7-10-14-21/h7-16,20,23,25H,5-6,17-19H2,1-4H3,(H,30,34)(H,31,36)/t20-,23+,25?/m1/s1 |
| InChIKey | GWFUIJNCNCDRME-HHDGPCQCSA-N |
| XLogP | 4.16 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.63 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|