C35H41N3O5 — CID 10031210
[(3R)-4,4-dimethyl-1-(4-phenylbenzoyl)pyrrolidin-3-yl] N-[(3S)-1,2-dioxo-1-[[(1R)-1-phenylethyl]amino]heptan-3-yl]carbamate (PubChem CID 10031210) has the molecular formula C35H41N3O5 and a molecular weight of 583.73 g/mol. Its IUPAC name is [(3R)-4,4-dimethyl-1-(4-phenylbenzoyl)pyrrolidin-3-yl] N-[(3S)-1,2-dioxo-1-[[(1R)-1-phenylethyl]amino]heptan-3-yl]carbamate.
| Compound Name | [(3R)-4,4-dimethyl-1-(4-phenylbenzoyl)pyrrolidin-3-yl] N-[(3S)-1,2-dioxo-1-[[(1R)-1-phenylethyl]amino]heptan-3-yl]carbamate |
|---|---|
| PubChem CID | 10031210 |
| Molecular Formula | C35H41N3O5 |
| Molecular Weight | 583.73 g/mol |
| Exact Mass | 583.30 |
| IUPAC Name | [(3R)-4,4-dimethyl-1-(4-phenylbenzoyl)pyrrolidin-3-yl] N-[(3S)-1,2-dioxo-1-[[(1R)-1-phenylethyl]amino]heptan-3-yl]carbamate |
| SMILES | CCCC[C@H](NC(=O)O[C@H]1CN(C(=O)c2ccc(-c3ccccc3)cc2)CC1(C)C)C(=O)C(=O)N[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C35H41N3O5/c1-5-6-17-29(31(39)32(40)36-24(2)25-13-9-7-10-14-25)37-34(42)43-30-22-38(23-35(30,3)4)33(41)28-20-18-27(19-21-28)26-15-11-8-12-16-26/h7-16,18-21,24,29-30H,5-6,17,22-23H2,1-4H3,(H,36,40)(H,37,42)/t24-,29+,30+/m1/s1 |
| InChIKey | YQVSOULIGXEKCS-FRDKBHKLSA-N |
| XLogP | 5.94 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.73 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|