C35H41N3O5 — CID 91439269
[4,4-dimethyl-1-(2-phenylbenzoyl)pyrrolidin-2-yl]-[(3S)-1,2-dioxo-1-[[(1R)-1-phenylethyl]amino]heptan-3-yl]carbamic acid (PubChem CID 91439269) has the molecular formula C35H41N3O5 and a molecular weight of 583.73 g/mol. Its IUPAC name is [4,4-dimethyl-1-(2-phenylbenzoyl)pyrrolidin-2-yl]-[(3S)-1,2-dioxo-1-[[(1R)-1-phenylethyl]amino]heptan-3-yl]carbamic acid.
| Compound Name | [4,4-dimethyl-1-(2-phenylbenzoyl)pyrrolidin-2-yl]-[(3S)-1,2-dioxo-1-[[(1R)-1-phenylethyl]amino]heptan-3-yl]carbamic acid |
|---|---|
| PubChem CID | 91439269 |
| Molecular Formula | C35H41N3O5 |
| Molecular Weight | 583.73 g/mol |
| Exact Mass | 583.30 |
| IUPAC Name | [4,4-dimethyl-1-(2-phenylbenzoyl)pyrrolidin-2-yl]-[(3S)-1,2-dioxo-1-[[(1R)-1-phenylethyl]amino]heptan-3-yl]carbamic acid |
| SMILES | CCCC[C@@H](C(=O)C(=O)N[C@H](C)c1ccccc1)N(C(=O)O)C1CC(C)(C)CN1C(=O)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C35H41N3O5/c1-5-6-21-29(31(39)32(40)36-24(2)25-15-9-7-10-16-25)38(34(42)43)30-22-35(3,4)23-37(30)33(41)28-20-14-13-19-27(28)26-17-11-8-12-18-26/h7-20,24,29-30H,5-6,21-23H2,1-4H3,(H,36,40)(H,42,43)/t24-,29+,30?/m1/s1 |
| InChIKey | OWNZRSIDHSNFQC-GIOYRQQSSA-N |
| XLogP | 6.54 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.73 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|