C18H28N2O2 — CID 108507880
N',N'-dibutyl-N-(1-phenylethyl)oxamide (PubChem CID 108507880) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is N',N'-dibutyl-N-(1-phenylethyl)oxamide.
| Compound Name | N',N'-dibutyl-N-(1-phenylethyl)oxamide |
|---|---|
| PubChem CID | 108507880 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | N',N'-dibutyl-N-(1-phenylethyl)oxamide |
| SMILES | CCCCN(CCCC)C(=O)C(=O)NC(C)c1ccccc1 |
| InChI | InChI=1S/C18H28N2O2/c1-4-6-13-20(14-7-5-2)18(22)17(21)19-15(3)16-11-9-8-10-12-16/h8-12,15H,4-7,13-14H2,1-3H3,(H,19,21) |
| InChIKey | KIUHNVGNBZCLOX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|