C19H30N2O4 — CID 108510078
N'-butyl-N-[1-(3,4-dimethoxyphenyl)ethyl]-N'-propyloxamide (PubChem CID 108510078) has the molecular formula C19H30N2O4 and a molecular weight of 350.46 g/mol. Its IUPAC name is N'-butyl-N-[1-(3,4-dimethoxyphenyl)ethyl]-N'-propyloxamide.
| Compound Name | N'-butyl-N-[1-(3,4-dimethoxyphenyl)ethyl]-N'-propyloxamide |
|---|---|
| PubChem CID | 108510078 |
| Molecular Formula | C19H30N2O4 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | N'-butyl-N-[1-(3,4-dimethoxyphenyl)ethyl]-N'-propyloxamide |
| SMILES | CCCCN(CCC)C(=O)C(=O)NC(C)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C19H30N2O4/c1-6-8-12-21(11-7-2)19(23)18(22)20-14(3)15-9-10-16(24-4)17(13-15)25-5/h9-10,13-14H,6-8,11-12H2,1-5H3,(H,20,22) |
| InChIKey | XCSFWNIASPASPT-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|