C15H22N2O3 — CID 108910581
1-[(E)-but-1-enyl]-3-[1-(3,4-dimethoxyphenyl)ethyl]urea (PubChem CID 108910581) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is 1-[(E)-but-1-enyl]-3-[1-(3,4-dimethoxyphenyl)ethyl]urea.
| Compound Name | 1-[(E)-but-1-enyl]-3-[1-(3,4-dimethoxyphenyl)ethyl]urea |
|---|---|
| PubChem CID | 108910581 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 1-[(E)-but-1-enyl]-3-[1-(3,4-dimethoxyphenyl)ethyl]urea |
| SMILES | CC/C=C/NC(=O)NC(C)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C15H22N2O3/c1-5-6-9-16-15(18)17-11(2)12-7-8-13(19-3)14(10-12)20-4/h6-11H,5H2,1-4H3,(H2,16,17,18)/b9-6+ |
| InChIKey | BARGZPOFGAYOLW-RMKNXTFCSA-N |
| XLogP | 2.99 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |