C17H24N2O4 — CID 108913137
1-[1-(3,4-dimethoxyphenyl)ethyl]-3-(oxan-4-ylidenemethyl)urea (PubChem CID 108913137) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is 1-[1-(3,4-dimethoxyphenyl)ethyl]-3-(oxan-4-ylidenemethyl)urea.
| Compound Name | 1-[1-(3,4-dimethoxyphenyl)ethyl]-3-(oxan-4-ylidenemethyl)urea |
|---|---|
| PubChem CID | 108913137 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 1-[1-(3,4-dimethoxyphenyl)ethyl]-3-(oxan-4-ylidenemethyl)urea |
| SMILES | COc1ccc(C(C)NC(=O)NC=C2CCOCC2)cc1OC |
| InChI | InChI=1S/C17H24N2O4/c1-12(14-4-5-15(21-2)16(10-14)22-3)19-17(20)18-11-13-6-8-23-9-7-13/h4-5,10-12H,6-9H2,1-3H3,(H2,18,19,20) |
| InChIKey | YIKZXSNACYCDMC-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |