C17H28N2O3 — CID 108896769
1-butyl-3-[(3,4-dimethoxyphenyl)methyl]-1-propylurea (PubChem CID 108896769) has the molecular formula C17H28N2O3 and a molecular weight of 308.42 g/mol. Its IUPAC name is 1-butyl-3-[(3,4-dimethoxyphenyl)methyl]-1-propylurea.
| Compound Name | 1-butyl-3-[(3,4-dimethoxyphenyl)methyl]-1-propylurea |
|---|---|
| PubChem CID | 108896769 |
| Molecular Formula | C17H28N2O3 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | 1-butyl-3-[(3,4-dimethoxyphenyl)methyl]-1-propylurea |
| SMILES | CCCCN(CCC)C(=O)NCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C17H28N2O3/c1-5-7-11-19(10-6-2)17(20)18-13-14-8-9-15(21-3)16(12-14)22-4/h8-9,12H,5-7,10-11,13H2,1-4H3,(H,18,20) |
| InChIKey | OVMAOPRZBNVCMK-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |