C20H32N2O4 — CID 102557257
3-[(3-ethoxy-4-methoxyphenyl)methyl]-1-(oxan-2-ylmethyl)-1-propylurea (PubChem CID 102557257) has the molecular formula C20H32N2O4 and a molecular weight of 364.49 g/mol. Its IUPAC name is 3-[(3-ethoxy-4-methoxyphenyl)methyl]-1-(oxan-2-ylmethyl)-1-propylurea.
| Compound Name | 3-[(3-ethoxy-4-methoxyphenyl)methyl]-1-(oxan-2-ylmethyl)-1-propylurea |
|---|---|
| PubChem CID | 102557257 |
| Molecular Formula | C20H32N2O4 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | 3-[(3-ethoxy-4-methoxyphenyl)methyl]-1-(oxan-2-ylmethyl)-1-propylurea |
| SMILES | CCCN(CC1CCCCO1)C(=O)NCc1ccc(OC)c(OCC)c1 |
| InChI | InChI=1S/C20H32N2O4/c1-4-11-22(15-17-8-6-7-12-26-17)20(23)21-14-16-9-10-18(24-3)19(13-16)25-5-2/h9-10,13,17H,4-8,11-12,14-15H2,1-3H3,(H,21,23) |
| InChIKey | JUMAAVVHXYPHFP-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |