C29H37N3O5 — CID 90996965
(1-benzoyl-4,4-dimethylpyrrolidin-2-yl)-[(3S)-1,2-dioxo-1-[[(1R)-1-phenylethyl]amino]heptan-3-yl]carbamic acid (PubChem CID 90996965) has the molecular formula C29H37N3O5 and a molecular weight of 507.63 g/mol. Its IUPAC name is (1-benzoyl-4,4-dimethylpyrrolidin-2-yl)-[(3S)-1,2-dioxo-1-[[(1R)-1-phenylethyl]amino]heptan-3-yl]carbamic acid.
| Compound Name | (1-benzoyl-4,4-dimethylpyrrolidin-2-yl)-[(3S)-1,2-dioxo-1-[[(1R)-1-phenylethyl]amino]heptan-3-yl]carbamic acid |
|---|---|
| PubChem CID | 90996965 |
| Molecular Formula | C29H37N3O5 |
| Molecular Weight | 507.63 g/mol |
| Exact Mass | 507.27 |
| IUPAC Name | (1-benzoyl-4,4-dimethylpyrrolidin-2-yl)-[(3S)-1,2-dioxo-1-[[(1R)-1-phenylethyl]amino]heptan-3-yl]carbamic acid |
| SMILES | CCCC[C@@H](C(=O)C(=O)N[C@H](C)c1ccccc1)N(C(=O)O)C1CC(C)(C)CN1C(=O)c1ccccc1 |
| InChI | InChI=1S/C29H37N3O5/c1-5-6-17-23(25(33)26(34)30-20(2)21-13-9-7-10-14-21)32(28(36)37)24-18-29(3,4)19-31(24)27(35)22-15-11-8-12-16-22/h7-16,20,23-24H,5-6,17-19H2,1-4H3,(H,30,34)(H,36,37)/t20-,23+,24?/m1/s1 |
| InChIKey | WKFWXYAYUNBPNI-FQCAPJHASA-N |
| XLogP | 4.87 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.63 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|