C27H34N2O4 — CID 69232696
(1-benzylcyclobutyl)-[(3S)-1,2-dioxo-1-[[(1R)-1-phenylethyl]amino]heptan-3-yl]carbamic acid (PubChem CID 69232696) has the molecular formula C27H34N2O4 and a molecular weight of 450.58 g/mol. Its IUPAC name is (1-benzylcyclobutyl)-[(3S)-1,2-dioxo-1-[[(1R)-1-phenylethyl]amino]heptan-3-yl]carbamic acid.
| Compound Name | (1-benzylcyclobutyl)-[(3S)-1,2-dioxo-1-[[(1R)-1-phenylethyl]amino]heptan-3-yl]carbamic acid |
|---|---|
| PubChem CID | 69232696 |
| Molecular Formula | C27H34N2O4 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | (1-benzylcyclobutyl)-[(3S)-1,2-dioxo-1-[[(1R)-1-phenylethyl]amino]heptan-3-yl]carbamic acid |
| SMILES | CCCC[C@@H](C(=O)C(=O)N[C@H](C)c1ccccc1)N(C(=O)O)C1(Cc2ccccc2)CCC1 |
| InChI | InChI=1S/C27H34N2O4/c1-3-4-16-23(24(30)25(31)28-20(2)22-14-9-6-10-15-22)29(26(32)33)27(17-11-18-27)19-21-12-7-5-8-13-21/h5-10,12-15,20,23H,3-4,11,16-19H2,1-2H3,(H,28,31)(H,32,33)/t20-,23+/m1/s1 |
| InChIKey | PQPBWFILDKFTJT-OFNKIYASSA-N |
| XLogP | 5.14 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|