C30H38F2N4O5 — CID 91493985
methyl N-[1-[(2,6-difluorophenyl)methyl]cyclobutyl]-N-[(3S)-7-(methylcarbamoylamino)-1,2-dioxo-1-[[(1R)-1-phenylethyl]amino]heptan-3-yl]carbamate (PubChem CID 91493985) has the molecular formula C30H38F2N4O5 and a molecular weight of 572.65 g/mol. Its IUPAC name is methyl N-[1-[(2,6-difluorophenyl)methyl]cyclobutyl]-N-[(3S)-7-(methylcarbamoylamino)-1,2-dioxo-1-[[(1R)-1-phenylethyl]amino]heptan-3-yl]carbamate.
| Compound Name | methyl N-[1-[(2,6-difluorophenyl)methyl]cyclobutyl]-N-[(3S)-7-(methylcarbamoylamino)-1,2-dioxo-1-[[(1R)-1-phenylethyl]amino]heptan-3-yl]carbamate |
|---|---|
| PubChem CID | 91493985 |
| Molecular Formula | C30H38F2N4O5 |
| Molecular Weight | 572.65 g/mol |
| Exact Mass | 572.28 |
| IUPAC Name | methyl N-[1-[(2,6-difluorophenyl)methyl]cyclobutyl]-N-[(3S)-7-(methylcarbamoylamino)-1,2-dioxo-1-[[(1R)-1-phenylethyl]amino]heptan-3-yl]carbamate |
| SMILES | CNC(=O)NCCCC[C@@H](C(=O)C(=O)N[C@H](C)c1ccccc1)N(C(=O)OC)C1(Cc2c(F)cccc2F)CCC1 |
| InChI | InChI=1S/C30H38F2N4O5/c1-20(21-11-5-4-6-12-21)35-27(38)26(37)25(15-7-8-18-34-28(39)33-2)36(29(40)41-3)30(16-10-17-30)19-22-23(31)13-9-14-24(22)32/h4-6,9,11-14,20,25H,7-8,10,15-19H2,1-3H3,(H,35,38)(H2,33,34,39)/t20-,25+/m1/s1 |
| InChIKey | IOLMFJWAKMZHFI-NLFFAJNJSA-N |
| XLogP | 4.41 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.65 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|