C18H28N4O5 — CID 69202969
[(3S)-2-hydroxy-7-(methylcarbamoylamino)-1-oxo-1-[[(1R)-1-phenylethyl]amino]heptan-3-yl]carbamic acid (PubChem CID 69202969) has the molecular formula C18H28N4O5 and a molecular weight of 380.45 g/mol. Its IUPAC name is [(3S)-2-hydroxy-7-(methylcarbamoylamino)-1-oxo-1-[[(1R)-1-phenylethyl]amino]heptan-3-yl]carbamic acid.
| Compound Name | [(3S)-2-hydroxy-7-(methylcarbamoylamino)-1-oxo-1-[[(1R)-1-phenylethyl]amino]heptan-3-yl]carbamic acid |
|---|---|
| PubChem CID | 69202969 |
| Molecular Formula | C18H28N4O5 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | [(3S)-2-hydroxy-7-(methylcarbamoylamino)-1-oxo-1-[[(1R)-1-phenylethyl]amino]heptan-3-yl]carbamic acid |
| SMILES | CNC(=O)NCCCC[C@H](NC(=O)O)C(O)C(=O)N[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C18H28N4O5/c1-12(13-8-4-3-5-9-13)21-16(24)15(23)14(22-18(26)27)10-6-7-11-20-17(25)19-2/h3-5,8-9,12,14-15,22-23H,6-7,10-11H2,1-2H3,(H,21,24)(H,26,27)(H2,19,20,25)/t12-,14+,15?/m1/s1 |
| InChIKey | INRAGDRVWHZLMC-JEIKQXNFSA-N |
| XLogP | 0.96 |
| TPSA | 139.79 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|