C28H39N3O6 — CID 69237119
tert-butyl-[(3S)-2-hydroxy-1-oxo-1-[[(1R)-1-phenylethyl]amino]-7-(phenylmethoxycarbonylamino)heptan-3-yl]carbamic acid (PubChem CID 69237119) has the molecular formula C28H39N3O6 and a molecular weight of 513.64 g/mol. Its IUPAC name is tert-butyl-[(3S)-2-hydroxy-1-oxo-1-[[(1R)-1-phenylethyl]amino]-7-(phenylmethoxycarbonylamino)heptan-3-yl]carbamic acid.
| Compound Name | tert-butyl-[(3S)-2-hydroxy-1-oxo-1-[[(1R)-1-phenylethyl]amino]-7-(phenylmethoxycarbonylamino)heptan-3-yl]carbamic acid |
|---|---|
| PubChem CID | 69237119 |
| Molecular Formula | C28H39N3O6 |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 513.28 |
| IUPAC Name | tert-butyl-[(3S)-2-hydroxy-1-oxo-1-[[(1R)-1-phenylethyl]amino]-7-(phenylmethoxycarbonylamino)heptan-3-yl]carbamic acid |
| SMILES | C[C@@H](NC(=O)C(O)[C@H](CCCCNC(=O)OCc1ccccc1)N(C(=O)O)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C28H39N3O6/c1-20(22-15-9-6-10-16-22)30-25(33)24(32)23(31(27(35)36)28(2,3)4)17-11-12-18-29-26(34)37-19-21-13-7-5-8-14-21/h5-10,13-16,20,23-24,32H,11-12,17-19H2,1-4H3,(H,29,34)(H,30,33)(H,35,36)/t20-,23+,24?/m1/s1 |
| InChIKey | GOQWTTJYLNPADF-FQCAPJHASA-N |
| XLogP | 4.47 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|