C23H32N2O6 — CID 91331127
[(4S)-4-ethyl-4-methyl-2-oxooxolan-3-yl] N-[(2S)-1-oxo-1-[2-[(1R)-1-phenylethyl]oxaziridin-3-yl]hexan-2-yl]carbamate (PubChem CID 91331127) has the molecular formula C23H32N2O6 and a molecular weight of 432.52 g/mol. Its IUPAC name is [(4S)-4-ethyl-4-methyl-2-oxooxolan-3-yl] N-[(2S)-1-oxo-1-[2-[(1R)-1-phenylethyl]oxaziridin-3-yl]hexan-2-yl]carbamate.
| Compound Name | [(4S)-4-ethyl-4-methyl-2-oxooxolan-3-yl] N-[(2S)-1-oxo-1-[2-[(1R)-1-phenylethyl]oxaziridin-3-yl]hexan-2-yl]carbamate |
|---|---|
| PubChem CID | 91331127 |
| Molecular Formula | C23H32N2O6 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | [(4S)-4-ethyl-4-methyl-2-oxooxolan-3-yl] N-[(2S)-1-oxo-1-[2-[(1R)-1-phenylethyl]oxaziridin-3-yl]hexan-2-yl]carbamate |
| SMILES | CCCC[C@H](NC(=O)OC1C(=O)OC[C@]1(C)CC)C(=O)C1ON1[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C23H32N2O6/c1-5-7-13-17(24-22(28)30-19-21(27)29-14-23(19,4)6-2)18(26)20-25(31-20)15(3)16-11-9-8-10-12-16/h8-12,15,17,19-20H,5-7,13-14H2,1-4H3,(H,24,28)/t15-,17+,19?,20?,23+,25?/m1/s1 |
| InChIKey | HNPQCRVOTQVUHV-HYAQPGDWSA-N |
| XLogP | 3.52 |
| TPSA | 97.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|