C26H34N4O5 — CID 91416348
[1-(pyrimidin-2-yloxymethyl)cyclobutyl]methyl N-[(2S)-1-oxo-1-[2-[(1R)-1-phenylethyl]oxaziridin-3-yl]hexan-2-yl]carbamate (PubChem CID 91416348) has the molecular formula C26H34N4O5 and a molecular weight of 482.58 g/mol. Its IUPAC name is [1-(pyrimidin-2-yloxymethyl)cyclobutyl]methyl N-[(2S)-1-oxo-1-[2-[(1R)-1-phenylethyl]oxaziridin-3-yl]hexan-2-yl]carbamate.
| Compound Name | [1-(pyrimidin-2-yloxymethyl)cyclobutyl]methyl N-[(2S)-1-oxo-1-[2-[(1R)-1-phenylethyl]oxaziridin-3-yl]hexan-2-yl]carbamate |
|---|---|
| PubChem CID | 91416348 |
| Molecular Formula | C26H34N4O5 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | [1-(pyrimidin-2-yloxymethyl)cyclobutyl]methyl N-[(2S)-1-oxo-1-[2-[(1R)-1-phenylethyl]oxaziridin-3-yl]hexan-2-yl]carbamate |
| SMILES | CCCC[C@H](NC(=O)OCC1(COc2ncccn2)CCC1)C(=O)C1ON1[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C26H34N4O5/c1-3-4-12-21(22(31)23-30(35-23)19(2)20-10-6-5-7-11-20)29-25(32)34-18-26(13-8-14-26)17-33-24-27-15-9-16-28-24/h5-7,9-11,15-16,19,21,23H,3-4,8,12-14,17-18H2,1-2H3,(H,29,32)/t19-,21+,23?,30?/m1/s1 |
| InChIKey | ZLNYYMMAZZBKIO-QXQCJJKASA-N |
| XLogP | 4.21 |
| TPSA | 105.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|