C24H35N3O5 — CID 91155696
(1-acetyl-4,4-dimethylpyrrolidin-2-yl) N-[(2S)-1-oxo-1-[2-[(1R)-1-phenylethyl]oxaziridin-3-yl]hexan-2-yl]carbamate (PubChem CID 91155696) has the molecular formula C24H35N3O5 and a molecular weight of 445.56 g/mol. Its IUPAC name is (1-acetyl-4,4-dimethylpyrrolidin-2-yl) N-[(2S)-1-oxo-1-[2-[(1R)-1-phenylethyl]oxaziridin-3-yl]hexan-2-yl]carbamate.
| Compound Name | (1-acetyl-4,4-dimethylpyrrolidin-2-yl) N-[(2S)-1-oxo-1-[2-[(1R)-1-phenylethyl]oxaziridin-3-yl]hexan-2-yl]carbamate |
|---|---|
| PubChem CID | 91155696 |
| Molecular Formula | C24H35N3O5 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.26 |
| IUPAC Name | (1-acetyl-4,4-dimethylpyrrolidin-2-yl) N-[(2S)-1-oxo-1-[2-[(1R)-1-phenylethyl]oxaziridin-3-yl]hexan-2-yl]carbamate |
| SMILES | CCCC[C@H](NC(=O)OC1CC(C)(C)CN1C(C)=O)C(=O)C1ON1[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C24H35N3O5/c1-6-7-13-19(21(29)22-27(32-22)16(2)18-11-9-8-10-12-18)25-23(30)31-20-14-24(4,5)15-26(20)17(3)28/h8-12,16,19-20,22H,6-7,13-15H2,1-5H3,(H,25,30)/t16-,19+,20?,22?,27?/m1/s1 |
| InChIKey | WDHHMQANNKLIFS-DLBDEZDWSA-N |
| XLogP | 3.78 |
| TPSA | 91.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|