C15H27NO4 — CID 11426158
(2S)-2-[(1-ethylcyclopentyl)methoxycarbonylamino]hexanoic acid (PubChem CID 11426158) has the molecular formula C15H27NO4 and a molecular weight of 285.38 g/mol. Its IUPAC name is (2S)-2-[(1-ethylcyclopentyl)methoxycarbonylamino]hexanoic acid.
| Compound Name | (2S)-2-[(1-ethylcyclopentyl)methoxycarbonylamino]hexanoic acid |
|---|---|
| PubChem CID | 11426158 |
| Molecular Formula | C15H27NO4 |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | (2S)-2-[(1-ethylcyclopentyl)methoxycarbonylamino]hexanoic acid |
| SMILES | CCCC[C@H](NC(=O)OCC1(CC)CCCC1)C(=O)O |
| InChI | InChI=1S/C15H27NO4/c1-3-5-8-12(13(17)18)16-14(19)20-11-15(4-2)9-6-7-10-15/h12H,3-11H2,1-2H3,(H,16,19)(H,17,18)/t12-/m0/s1 |
| InChIKey | QQGYQPFCFWLKIE-LBPRGKRZSA-N |
| XLogP | 3.33 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |