C18H24N2O2 — CID 102041016
tert-butyl N-[(1-benzyl-5-methylpyrrol-2-yl)methyl]carbamate (PubChem CID 102041016) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is tert-butyl N-[(1-benzyl-5-methylpyrrol-2-yl)methyl]carbamate.
| Compound Name | tert-butyl N-[(1-benzyl-5-methylpyrrol-2-yl)methyl]carbamate |
|---|---|
| PubChem CID | 102041016 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | tert-butyl N-[(1-benzyl-5-methylpyrrol-2-yl)methyl]carbamate |
| SMILES | Cc1ccc(CNC(=O)OC(C)(C)C)n1Cc1ccccc1 |
| InChI | InChI=1S/C18H24N2O2/c1-14-10-11-16(12-19-17(21)22-18(2,3)4)20(14)13-15-8-6-5-7-9-15/h5-11H,12-13H2,1-4H3,(H,19,21) |
| InChIKey | AINBPWLSCPEPAL-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_N(1)', 'substructure': 'N/A'} |
|---|