C26H23NO5 — CID 102129823
tert-butyl 3-(3,6-dioxocyclohexa-1,4-dien-1-yl)-3-(4-methylphenyl)-2-oxoindole-1-carboxylate (PubChem CID 102129823) has the molecular formula C26H23NO5 and a molecular weight of 429.47 g/mol. Its IUPAC name is tert-butyl 3-(3,6-dioxocyclohexa-1,4-dien-1-yl)-3-(4-methylphenyl)-2-oxoindole-1-carboxylate.
| Compound Name | tert-butyl 3-(3,6-dioxocyclohexa-1,4-dien-1-yl)-3-(4-methylphenyl)-2-oxoindole-1-carboxylate |
|---|---|
| PubChem CID | 102129823 |
| Molecular Formula | C26H23NO5 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | tert-butyl 3-(3,6-dioxocyclohexa-1,4-dien-1-yl)-3-(4-methylphenyl)-2-oxoindole-1-carboxylate |
| SMILES | Cc1ccc(C2(C3=CC(=O)C=CC3=O)C(=O)N(C(=O)OC(C)(C)C)c3ccccc32)cc1 |
| InChI | InChI=1S/C26H23NO5/c1-16-9-11-17(12-10-16)26(20-15-18(28)13-14-22(20)29)19-7-5-6-8-21(19)27(23(26)30)24(31)32-25(2,3)4/h5-15H,1-4H3 |
| InChIKey | WXPNRXYZLAYDJO-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|