C33H27NO9 — CID 102457507
tert-butyl (3R)-3-(5,8-diacetyloxy-1,4-dioxonaphthalen-2-yl)-2-oxo-3-phenylindole-1-carboxylate (PubChem CID 102457507) has the molecular formula C33H27NO9 and a molecular weight of 581.58 g/mol. Its IUPAC name is tert-butyl (3R)-3-(5,8-diacetyloxy-1,4-dioxonaphthalen-2-yl)-2-oxo-3-phenylindole-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-(5,8-diacetyloxy-1,4-dioxonaphthalen-2-yl)-2-oxo-3-phenylindole-1-carboxylate |
|---|---|
| PubChem CID | 102457507 |
| Molecular Formula | C33H27NO9 |
| Molecular Weight | 581.58 g/mol |
| Exact Mass | 581.17 |
| IUPAC Name | tert-butyl (3R)-3-(5,8-diacetyloxy-1,4-dioxonaphthalen-2-yl)-2-oxo-3-phenylindole-1-carboxylate |
| SMILES | CC(=O)Oc1ccc(OC(C)=O)c2c1C(=O)C=C([C@]1(c3ccccc3)C(=O)N(C(=O)OC(C)(C)C)c3ccccc31)C2=O |
| InChI | InChI=1S/C33H27NO9/c1-18(35)41-25-15-16-26(42-19(2)36)28-27(25)24(37)17-22(29(28)38)33(20-11-7-6-8-12-20)21-13-9-10-14-23(21)34(30(33)39)31(40)43-32(3,4)5/h6-17H,1-5H3/t33-/m1/s1 |
| InChIKey | HLGJIPXOVADSQP-MGBGTMOVSA-N |
| XLogP | 5.11 |
| TPSA | 133.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.58 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|