C27H25NO6 — CID 102129830
tert-butyl 3-(3,6-dioxocyclohexa-1,4-dien-1-yl)-3-[(3-methoxyphenyl)methyl]-2-oxoindole-1-carboxylate (PubChem CID 102129830) has the molecular formula C27H25NO6 and a molecular weight of 459.50 g/mol. Its IUPAC name is tert-butyl 3-(3,6-dioxocyclohexa-1,4-dien-1-yl)-3-[(3-methoxyphenyl)methyl]-2-oxoindole-1-carboxylate.
| Compound Name | tert-butyl 3-(3,6-dioxocyclohexa-1,4-dien-1-yl)-3-[(3-methoxyphenyl)methyl]-2-oxoindole-1-carboxylate |
|---|---|
| PubChem CID | 102129830 |
| Molecular Formula | C27H25NO6 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | tert-butyl 3-(3,6-dioxocyclohexa-1,4-dien-1-yl)-3-[(3-methoxyphenyl)methyl]-2-oxoindole-1-carboxylate |
| SMILES | COc1cccc(CC2(C3=CC(=O)C=CC3=O)C(=O)N(C(=O)OC(C)(C)C)c3ccccc32)c1 |
| InChI | InChI=1S/C27H25NO6/c1-26(2,3)34-25(32)28-22-11-6-5-10-20(22)27(24(28)31,21-15-18(29)12-13-23(21)30)16-17-8-7-9-19(14-17)33-4/h5-15H,16H2,1-4H3 |
| InChIKey | PXVPUXFOLIHAOK-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|