C31H34FNO6 — CID 135055060
ditert-butyl (1R,2S,5R,6S)-5'-fluoro-4-formyl-2-methyl-2'-oxo-5-phenylspiro[cyclohex-3-ene-6,3'-indole]-1,1'-dicarboxylate (PubChem CID 135055060) has the molecular formula C31H34FNO6 and a molecular weight of 535.61 g/mol. Its IUPAC name is ditert-butyl (1R,2S,5R,6S)-5'-fluoro-4-formyl-2-methyl-2'-oxo-5-phenylspiro[cyclohex-3-ene-6,3'-indole]-1,1'-dicarboxylate.
| Compound Name | ditert-butyl (1R,2S,5R,6S)-5'-fluoro-4-formyl-2-methyl-2'-oxo-5-phenylspiro[cyclohex-3-ene-6,3'-indole]-1,1'-dicarboxylate |
|---|---|
| PubChem CID | 135055060 |
| Molecular Formula | C31H34FNO6 |
| Molecular Weight | 535.61 g/mol |
| Exact Mass | 535.24 |
| IUPAC Name | ditert-butyl (1R,2S,5R,6S)-5'-fluoro-4-formyl-2-methyl-2'-oxo-5-phenylspiro[cyclohex-3-ene-6,3'-indole]-1,1'-dicarboxylate |
| SMILES | C[C@H]1C=C(C=O)[C@@H](c2ccccc2)[C@]2(C(=O)N(C(=O)OC(C)(C)C)c3ccc(F)cc32)[C@@H]1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C31H34FNO6/c1-18-15-20(17-34)25(19-11-9-8-10-12-19)31(24(18)26(35)38-29(2,3)4)22-16-21(32)13-14-23(22)33(27(31)36)28(37)39-30(5,6)7/h8-18,24-25H,1-7H3/t18-,24-,25+,31+/m0/s1 |
| InChIKey | RHWCOLDZICAHMX-FARQRRHWSA-N |
| XLogP | 5.86 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.61 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|