C32H36ClNO8 — CID 132819295
1-O'-tert-butyl 1-O-ethyl (1R,2R,3S,4S,5R,6S)-2-acetyl-5'-chloro-4-formyl-3-hydroxy-2,3-dimethyl-2'-oxo-5-phenylspiro[cyclohexane-6,3'-indole]-1,1'-dicarboxylate (PubChem CID 132819295) has the molecular formula C32H36ClNO8 and a molecular weight of 598.09 g/mol. Its IUPAC name is 1-O'-tert-butyl 1-O-ethyl (1R,2R,3S,4S,5R,6S)-2-acetyl-5'-chloro-4-formyl-3-hydroxy-2,3-dimethyl-2'-oxo-5-phenylspiro[cyclohexane-6,3'-indole]-1,1'-dicarboxylate.
| Compound Name | 1-O'-tert-butyl 1-O-ethyl (1R,2R,3S,4S,5R,6S)-2-acetyl-5'-chloro-4-formyl-3-hydroxy-2,3-dimethyl-2'-oxo-5-phenylspiro[cyclohexane-6,3'-indole]-1,1'-dicarboxylate |
|---|---|
| PubChem CID | 132819295 |
| Molecular Formula | C32H36ClNO8 |
| Molecular Weight | 598.09 g/mol |
| Exact Mass | 597.21 |
| IUPAC Name | 1-O'-tert-butyl 1-O-ethyl (1R,2R,3S,4S,5R,6S)-2-acetyl-5'-chloro-4-formyl-3-hydroxy-2,3-dimethyl-2'-oxo-5-phenylspiro[cyclohexane-6,3'-indole]-1,1'-dicarboxylate |
| SMILES | CCOC(=O)[C@H]1[C@@]2(C(=O)N(C(=O)OC(C)(C)C)c3ccc(Cl)cc32)[C@@H](c2ccccc2)[C@H](C=O)[C@](C)(O)[C@]1(C)C(C)=O |
| InChI | InChI=1S/C32H36ClNO8/c1-8-41-26(37)25-30(6,18(2)36)31(7,40)22(17-35)24(19-12-10-9-11-13-19)32(25)21-16-20(33)14-15-23(21)34(27(32)38)28(39)42-29(3,4)5/h9-17,22,24-25,40H,8H2,1-7H3/t22-,24-,25+,30+,31-,32-/m0/s1 |
| InChIKey | WHSZZEQYXZDVFQ-VRTOCLNTSA-N |
| XLogP | 5.00 |
| TPSA | 127.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.09 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|