C27H26BrNO7 — CID 139185573
1-O'-tert-butyl 1-O-ethyl (1S,2S,3S)-2-(4-bromobenzoyl)-2',5-dioxospiro[cyclopentane-3,3'-indole]-1,1'-dicarboxylate (PubChem CID 139185573) has the molecular formula C27H26BrNO7 and a molecular weight of 556.41 g/mol. Its IUPAC name is 1-O'-tert-butyl 1-O-ethyl (1S,2S,3S)-2-(4-bromobenzoyl)-2',5-dioxospiro[cyclopentane-3,3'-indole]-1,1'-dicarboxylate.
| Compound Name | 1-O'-tert-butyl 1-O-ethyl (1S,2S,3S)-2-(4-bromobenzoyl)-2',5-dioxospiro[cyclopentane-3,3'-indole]-1,1'-dicarboxylate |
|---|---|
| PubChem CID | 139185573 |
| Molecular Formula | C27H26BrNO7 |
| Molecular Weight | 556.41 g/mol |
| Exact Mass | 555.09 |
| IUPAC Name | 1-O'-tert-butyl 1-O-ethyl (1S,2S,3S)-2-(4-bromobenzoyl)-2',5-dioxospiro[cyclopentane-3,3'-indole]-1,1'-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1C(=O)C[C@]2(C(=O)N(C(=O)OC(C)(C)C)c3ccccc32)[C@H]1C(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C27H26BrNO7/c1-5-35-23(32)20-19(30)14-27(21(20)22(31)15-10-12-16(28)13-11-15)17-8-6-7-9-18(17)29(24(27)33)25(34)36-26(2,3)4/h6-13,20-21H,5,14H2,1-4H3/t20-,21-,27-/m1/s1 |
| InChIKey | FFFAIIDCOCWUIV-LGVUCKNBSA-N |
| XLogP | 4.62 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.41 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|