C54H52Br2N2O14 — CID 139185572
1-O'-tert-butyl 1-O-ethyl (1S,2S,3S)-2-(4-bromobenzoyl)-2',5-dioxospiro[cyclopentane-3,3'-indole]-1,1'-dicarboxylate (PubChem CID 139185572) has the molecular formula C54H52Br2N2O14 and a molecular weight of 1112.82 g/mol. Its IUPAC name is 1-O'-tert-butyl 1-O-ethyl (1S,2S,3S)-2-(4-bromobenzoyl)-2',5-dioxospiro[cyclopentane-3,3'-indole]-1,1'-dicarboxylate.
| Compound Name | 1-O'-tert-butyl 1-O-ethyl (1S,2S,3S)-2-(4-bromobenzoyl)-2',5-dioxospiro[cyclopentane-3,3'-indole]-1,1'-dicarboxylate |
|---|---|
| PubChem CID | 139185572 |
| Molecular Formula | C54H52Br2N2O14 |
| Molecular Weight | 1112.82 g/mol |
| Exact Mass | 1110.18 |
| IUPAC Name | 1-O'-tert-butyl 1-O-ethyl (1S,2S,3S)-2-(4-bromobenzoyl)-2',5-dioxospiro[cyclopentane-3,3'-indole]-1,1'-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1C(=O)C[C@]2(C(=O)N(C(=O)OC(C)(C)C)c3ccccc32)[C@H]1C(=O)c1ccc(Br)cc1.CCOC(=O)[C@@H]1C(=O)C[C@]2(C(=O)N(C(=O)OC(C)(C)C)c3ccccc32)[C@H]1C(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/2C27H26BrNO7/c2*1-5-35-23(32)20-19(30)14-27(21(20)22(31)15-10-12-16(28)13-11-15)17-8-6-7-9-18(17)29(24(27)33)25(34)36-26(2,3)4/h2*6-13,20-21H,5,14H2,1-4H3/t2*20-,21-,27-/m11/s1 |
| InChIKey | UXOQJNCEQLLHRY-YETSDKRUSA-N |
| XLogP | 9.24 |
| TPSA | 214.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 72 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1112.82 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|