C26H25NO4S — CID 102488067
tert-butyl (3S)-5-methoxy-2-oxo-3-phenyl-3-phenylsulfanylindole-1-carboxylate (PubChem CID 102488067) has the molecular formula C26H25NO4S and a molecular weight of 447.56 g/mol. Its IUPAC name is tert-butyl (3S)-5-methoxy-2-oxo-3-phenyl-3-phenylsulfanylindole-1-carboxylate.
| Compound Name | tert-butyl (3S)-5-methoxy-2-oxo-3-phenyl-3-phenylsulfanylindole-1-carboxylate |
|---|---|
| PubChem CID | 102488067 |
| Molecular Formula | C26H25NO4S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | tert-butyl (3S)-5-methoxy-2-oxo-3-phenyl-3-phenylsulfanylindole-1-carboxylate |
| SMILES | COc1ccc2c(c1)[C@@](Sc1ccccc1)(c1ccccc1)C(=O)N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H25NO4S/c1-25(2,3)31-24(29)27-22-16-15-19(30-4)17-21(22)26(23(27)28,18-11-7-5-8-12-18)32-20-13-9-6-10-14-20/h5-17H,1-4H3/t26-/m0/s1 |
| InChIKey | FCTNASVGOPBILT-SANMLTNESA-N |
| XLogP | 6.01 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |