C22H23NO4S — CID 162678745
tert-butyl (3S)-5-methoxy-3-methyl-2-oxo-3-(3-thiophen-2-ylprop-2-ynyl)indole-1-carboxylate (PubChem CID 162678745) has the molecular formula C22H23NO4S and a molecular weight of 397.50 g/mol. Its IUPAC name is tert-butyl (3S)-5-methoxy-3-methyl-2-oxo-3-(3-thiophen-2-ylprop-2-ynyl)indole-1-carboxylate.
| Compound Name | tert-butyl (3S)-5-methoxy-3-methyl-2-oxo-3-(3-thiophen-2-ylprop-2-ynyl)indole-1-carboxylate |
|---|---|
| PubChem CID | 162678745 |
| Molecular Formula | C22H23NO4S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | tert-butyl (3S)-5-methoxy-3-methyl-2-oxo-3-(3-thiophen-2-ylprop-2-ynyl)indole-1-carboxylate |
| SMILES | COc1ccc2c(c1)[C@](C)(CC#Cc1cccs1)C(=O)N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H23NO4S/c1-21(2,3)27-20(25)23-18-11-10-15(26-5)14-17(18)22(4,19(23)24)12-6-8-16-9-7-13-28-16/h7,9-11,13-14H,12H2,1-5H3/t22-/m0/s1 |
| InChIKey | QQGGCLWGBKKZHI-QFIPXVFZSA-N |
| XLogP | 4.74 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|