C33H34NO6P — CID 102221360
tert-butyl (3S,4S,5S)-5-diphenylphosphoryl-5'-methoxy-2'-oxo-3-(2-oxoethyl)spiro[cyclohexene-4,3'-indole]-1'-carboxylate (PubChem CID 102221360) has the molecular formula C33H34NO6P and a molecular weight of 571.61 g/mol. Its IUPAC name is tert-butyl (3S,4S,5S)-5-diphenylphosphoryl-5'-methoxy-2'-oxo-3-(2-oxoethyl)spiro[cyclohexene-4,3'-indole]-1'-carboxylate.
| Compound Name | tert-butyl (3S,4S,5S)-5-diphenylphosphoryl-5'-methoxy-2'-oxo-3-(2-oxoethyl)spiro[cyclohexene-4,3'-indole]-1'-carboxylate |
|---|---|
| PubChem CID | 102221360 |
| Molecular Formula | C33H34NO6P |
| Molecular Weight | 571.61 g/mol |
| Exact Mass | 571.21 |
| IUPAC Name | tert-butyl (3S,4S,5S)-5-diphenylphosphoryl-5'-methoxy-2'-oxo-3-(2-oxoethyl)spiro[cyclohexene-4,3'-indole]-1'-carboxylate |
| SMILES | COc1ccc2c(c1)[C@]1(C(=O)N2C(=O)OC(C)(C)C)[C@@H](CC=O)C=CC[C@@H]1P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H34NO6P/c1-32(2,3)40-31(37)34-28-19-18-24(39-4)22-27(28)33(30(34)36)23(20-21-35)12-11-17-29(33)41(38,25-13-7-5-8-14-25)26-15-9-6-10-16-26/h5-16,18-19,21-23,29H,17,20H2,1-4H3/t23-,29+,33-/m1/s1 |
| InChIKey | NMQUHTYXJXPVLO-SMQOBQFBSA-N |
| XLogP | 5.76 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.61 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|