C32H31NO6 — CID 122204492
tert-butyl (5S,6R)-1-methoxy-6-methyl-2',3-dioxo-5-(3-phenoxyphenyl)spiro[cyclohexene-4,3'-indole]-1'-carboxylate (PubChem CID 122204492) has the molecular formula C32H31NO6 and a molecular weight of 525.60 g/mol. Its IUPAC name is tert-butyl (5S,6R)-1-methoxy-6-methyl-2',3-dioxo-5-(3-phenoxyphenyl)spiro[cyclohexene-4,3'-indole]-1'-carboxylate.
| Compound Name | tert-butyl (5S,6R)-1-methoxy-6-methyl-2',3-dioxo-5-(3-phenoxyphenyl)spiro[cyclohexene-4,3'-indole]-1'-carboxylate |
|---|---|
| PubChem CID | 122204492 |
| Molecular Formula | C32H31NO6 |
| Molecular Weight | 525.60 g/mol |
| Exact Mass | 525.22 |
| IUPAC Name | tert-butyl (5S,6R)-1-methoxy-6-methyl-2',3-dioxo-5-(3-phenoxyphenyl)spiro[cyclohexene-4,3'-indole]-1'-carboxylate |
| SMILES | COC1=CC(=O)C2(C(=O)N(C(=O)OC(C)(C)C)c3ccccc32)[C@H](c2cccc(Oc3ccccc3)c2)[C@H]1C |
| InChI | InChI=1S/C32H31NO6/c1-20-26(37-5)19-27(34)32(28(20)21-12-11-15-23(18-21)38-22-13-7-6-8-14-22)24-16-9-10-17-25(24)33(29(32)35)30(36)39-31(2,3)4/h6-20,28H,1-5H3/t20-,28-,32?/m0/s1 |
| InChIKey | AYQDHRNXGBQBLC-FEXDLXPWSA-N |
| XLogP | 6.53 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.60 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|