C11H8N2O6 — CID 60702078
4-(2,5-dioxopyrrolidin-1-yl)-3-nitrobenzoic acid (PubChem CID 60702078) has the molecular formula C11H8N2O6 and a molecular weight of 264.19 g/mol. Its IUPAC name is 4-(2,5-dioxopyrrolidin-1-yl)-3-nitrobenzoic acid.
| Compound Name | 4-(2,5-dioxopyrrolidin-1-yl)-3-nitrobenzoic acid |
|---|---|
| PubChem CID | 60702078 |
| Molecular Formula | C11H8N2O6 |
| Molecular Weight | 264.19 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | 4-(2,5-dioxopyrrolidin-1-yl)-3-nitrobenzoic acid |
| SMILES | O=C(O)c1ccc(N2C(=O)CCC2=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H8N2O6/c14-9-3-4-10(15)12(9)7-2-1-6(11(16)17)5-8(7)13(18)19/h1-2,5H,3-4H2,(H,16,17) |
| InChIKey | LJVDQTJIIKNHEW-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 117.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.19 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|