C19H23NO5 — CID 98155491
methyl (1S,3S,6R,9R)-9-(2,4-dimethylphenyl)-6,8-dimethyl-4-oxo-2,5-dioxa-8-azatricyclo[4.4.0.01,3]decane-3-carboxylate (PubChem CID 98155491) has the molecular formula C19H23NO5 and a molecular weight of 345.40 g/mol. Its IUPAC name is methyl (1S,3S,6R,9R)-9-(2,4-dimethylphenyl)-6,8-dimethyl-4-oxo-2,5-dioxa-8-azatricyclo[4.4.0.01,3]decane-3-carboxylate.
| Compound Name | methyl (1S,3S,6R,9R)-9-(2,4-dimethylphenyl)-6,8-dimethyl-4-oxo-2,5-dioxa-8-azatricyclo[4.4.0.01,3]decane-3-carboxylate |
|---|---|
| PubChem CID | 98155491 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | methyl (1S,3S,6R,9R)-9-(2,4-dimethylphenyl)-6,8-dimethyl-4-oxo-2,5-dioxa-8-azatricyclo[4.4.0.01,3]decane-3-carboxylate |
| SMILES | COC(=O)[C@@]12O[C@]13C[C@H](c1ccc(C)cc1C)N(C)C[C@@]3(C)OC2=O |
| InChI | InChI=1S/C19H23NO5/c1-11-6-7-13(12(2)8-11)14-9-18-17(3,10-20(14)4)24-16(22)19(18,25-18)15(21)23-5/h6-8,14H,9-10H2,1-5H3/t14-,17-,18+,19+/m1/s1 |
| InChIKey | YXVJIMLLOWNOQQ-OAOYMFHYSA-N |
| XLogP | 1.68 |
| TPSA | 68.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|