C26H26N2O5 — CID 129440638
methyl (1S,3R,6S,9R)-9-(1-benzylindol-3-yl)-6,8-dimethyl-4-oxo-2,5-dioxa-8-azatricyclo[4.4.0.01,3]decane-3-carboxylate (PubChem CID 129440638) has the molecular formula C26H26N2O5 and a molecular weight of 446.50 g/mol. Its IUPAC name is methyl (1S,3R,6S,9R)-9-(1-benzylindol-3-yl)-6,8-dimethyl-4-oxo-2,5-dioxa-8-azatricyclo[4.4.0.01,3]decane-3-carboxylate.
| Compound Name | methyl (1S,3R,6S,9R)-9-(1-benzylindol-3-yl)-6,8-dimethyl-4-oxo-2,5-dioxa-8-azatricyclo[4.4.0.01,3]decane-3-carboxylate |
|---|---|
| PubChem CID | 129440638 |
| Molecular Formula | C26H26N2O5 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | methyl (1S,3R,6S,9R)-9-(1-benzylindol-3-yl)-6,8-dimethyl-4-oxo-2,5-dioxa-8-azatricyclo[4.4.0.01,3]decane-3-carboxylate |
| SMILES | COC(=O)[C@]12O[C@]13C[C@H](c1cn(Cc4ccccc4)c4ccccc14)N(C)C[C@]3(C)OC2=O |
| InChI | InChI=1S/C26H26N2O5/c1-24-16-27(2)21(13-25(24)26(33-25,22(29)31-3)23(30)32-24)19-15-28(14-17-9-5-4-6-10-17)20-12-8-7-11-18(19)20/h4-12,15,21H,13-14,16H2,1-3H3/t21-,24+,25+,26-/m1/s1 |
| InChIKey | UQNWCSVKAOWFCG-CBRSEMLDSA-N |
| XLogP | 3.06 |
| TPSA | 73.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|