C25H25NO7 — CID 129431446
methyl (1S,3R,6S,9S)-9-(1,3-benzodioxol-5-ylmethyl)-8-benzyl-6-methyl-4-oxo-2,5-dioxa-8-azatricyclo[4.4.0.01,3]decane-3-carboxylate (PubChem CID 129431446) has the molecular formula C25H25NO7 and a molecular weight of 451.48 g/mol. Its IUPAC name is methyl (1S,3R,6S,9S)-9-(1,3-benzodioxol-5-ylmethyl)-8-benzyl-6-methyl-4-oxo-2,5-dioxa-8-azatricyclo[4.4.0.01,3]decane-3-carboxylate.
| Compound Name | methyl (1S,3R,6S,9S)-9-(1,3-benzodioxol-5-ylmethyl)-8-benzyl-6-methyl-4-oxo-2,5-dioxa-8-azatricyclo[4.4.0.01,3]decane-3-carboxylate |
|---|---|
| PubChem CID | 129431446 |
| Molecular Formula | C25H25NO7 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | methyl (1S,3R,6S,9S)-9-(1,3-benzodioxol-5-ylmethyl)-8-benzyl-6-methyl-4-oxo-2,5-dioxa-8-azatricyclo[4.4.0.01,3]decane-3-carboxylate |
| SMILES | COC(=O)[C@]12O[C@]13C[C@H](Cc1ccc4c(c1)OCO4)N(Cc1ccccc1)C[C@]3(C)OC2=O |
| InChI | InChI=1S/C25H25NO7/c1-23-14-26(13-16-6-4-3-5-7-16)18(10-17-8-9-19-20(11-17)31-15-30-19)12-24(23)25(33-24,21(27)29-2)22(28)32-23/h3-9,11,18H,10,12-15H2,1-2H3/t18-,23-,24-,25+/m0/s1 |
| InChIKey | SOQUDIVDRACZOC-PAWHMVCQSA-N |
| XLogP | 2.23 |
| TPSA | 86.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|