C26H25N3O5 — CID 41119412
(5S)-3-[2-[1-(1,3-benzodioxol-5-ylmethyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]-5-benzylimidazolidine-2,4-dione (PubChem CID 41119412) has the molecular formula C26H25N3O5 and a molecular weight of 459.50 g/mol. Its IUPAC name is (5S)-3-[2-[1-(1,3-benzodioxol-5-ylmethyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]-5-benzylimidazolidine-2,4-dione.
| Compound Name | (5S)-3-[2-[1-(1,3-benzodioxol-5-ylmethyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]-5-benzylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 41119412 |
| Molecular Formula | C26H25N3O5 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | (5S)-3-[2-[1-(1,3-benzodioxol-5-ylmethyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]-5-benzylimidazolidine-2,4-dione |
| SMILES | Cc1cc(C(=O)CN2C(=O)N[C@@H](Cc3ccccc3)C2=O)c(C)n1Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C26H25N3O5/c1-16-10-20(17(2)28(16)13-19-8-9-23-24(12-19)34-15-33-23)22(30)14-29-25(31)21(27-26(29)32)11-18-6-4-3-5-7-18/h3-10,12,21H,11,13-15H2,1-2H3,(H,27,32)/t21-/m0/s1 |
| InChIKey | SMHUTJAZMOJLDR-NRFANRHFSA-N |
| XLogP | 3.23 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|