C27H25N3O6 — CID 4784203
3'-[2-[1-(1,3-benzodioxol-5-ylmethyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]spiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione (PubChem CID 4784203) has the molecular formula C27H25N3O6 and a molecular weight of 487.51 g/mol. Its IUPAC name is 3'-[2-[1-(1,3-benzodioxol-5-ylmethyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]spiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione.
| Compound Name | 3'-[2-[1-(1,3-benzodioxol-5-ylmethyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]spiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 4784203 |
| Molecular Formula | C27H25N3O6 |
| Molecular Weight | 487.51 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | 3'-[2-[1-(1,3-benzodioxol-5-ylmethyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]spiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione |
| SMILES | Cc1cc(C(=O)CN2C(=O)NC3(CCOc4ccccc43)C2=O)c(C)n1Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C27H25N3O6/c1-16-11-19(17(2)29(16)13-18-7-8-23-24(12-18)36-15-35-23)21(31)14-30-25(32)27(28-26(30)33)9-10-34-22-6-4-3-5-20(22)27/h3-8,11-12H,9-10,13-15H2,1-2H3,(H,28,33) |
| InChIKey | SGCJFYCZENGMPB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.51 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|