C21H23N3O3 — CID 17445712
5-benzyl-3-[2-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl]imidazolidine-2,4-dione (PubChem CID 17445712) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is 5-benzyl-3-[2-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl]imidazolidine-2,4-dione.
| Compound Name | 5-benzyl-3-[2-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 17445712 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 5-benzyl-3-[2-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl]imidazolidine-2,4-dione |
| SMILES | Cc1cc(C(=O)CN2C(=O)NC(Cc3ccccc3)C2=O)c(C)n1C1CC1 |
| InChI | InChI=1S/C21H23N3O3/c1-13-10-17(14(2)24(13)16-8-9-16)19(25)12-23-20(26)18(22-21(23)27)11-15-6-4-3-5-7-15/h3-7,10,16,18H,8-9,11-12H2,1-2H3,(H,22,27) |
| InChIKey | DEMZJEAHYXTTJM-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|