C22H27N3O3 — CID 2108646
(5S)-3-[2-(2,5-dimethyl-1-propylpyrrol-3-yl)-2-oxoethyl]-5-(2-phenylethyl)imidazolidine-2,4-dione (PubChem CID 2108646) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is (5S)-3-[2-(2,5-dimethyl-1-propylpyrrol-3-yl)-2-oxoethyl]-5-(2-phenylethyl)imidazolidine-2,4-dione.
| Compound Name | (5S)-3-[2-(2,5-dimethyl-1-propylpyrrol-3-yl)-2-oxoethyl]-5-(2-phenylethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 2108646 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | (5S)-3-[2-(2,5-dimethyl-1-propylpyrrol-3-yl)-2-oxoethyl]-5-(2-phenylethyl)imidazolidine-2,4-dione |
| SMILES | CCCn1c(C)cc(C(=O)CN2C(=O)N[C@@H](CCc3ccccc3)C2=O)c1C |
| InChI | InChI=1S/C22H27N3O3/c1-4-12-24-15(2)13-18(16(24)3)20(26)14-25-21(27)19(23-22(25)28)11-10-17-8-6-5-7-9-17/h5-9,13,19H,4,10-12,14H2,1-3H3,(H,23,28)/t19-/m0/s1 |
| InChIKey | ALZUJOYBYXXGOQ-IBGZPJMESA-N |
| XLogP | 3.25 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|