C19H23N3O3S — CID 26217537
(5S)-3-[2-[2,5-dimethyl-1-(thiophen-2-ylmethyl)pyrrol-3-yl]-2-oxoethyl]-5-propylimidazolidine-2,4-dione (PubChem CID 26217537) has the molecular formula C19H23N3O3S and a molecular weight of 373.48 g/mol. Its IUPAC name is (5S)-3-[2-[2,5-dimethyl-1-(thiophen-2-ylmethyl)pyrrol-3-yl]-2-oxoethyl]-5-propylimidazolidine-2,4-dione.
| Compound Name | (5S)-3-[2-[2,5-dimethyl-1-(thiophen-2-ylmethyl)pyrrol-3-yl]-2-oxoethyl]-5-propylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 26217537 |
| Molecular Formula | C19H23N3O3S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | (5S)-3-[2-[2,5-dimethyl-1-(thiophen-2-ylmethyl)pyrrol-3-yl]-2-oxoethyl]-5-propylimidazolidine-2,4-dione |
| SMILES | CCC[C@@H]1NC(=O)N(CC(=O)c2cc(C)n(Cc3cccs3)c2C)C1=O |
| InChI | InChI=1S/C19H23N3O3S/c1-4-6-16-18(24)22(19(25)20-16)11-17(23)15-9-12(2)21(13(15)3)10-14-7-5-8-26-14/h5,7-9,16H,4,6,10-11H2,1-3H3,(H,20,25)/t16-/m0/s1 |
| InChIKey | XFJXBYUDJUTGFV-INIZCTEOSA-N |
| XLogP | 3.12 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|