C21H25N3O4S — CID 16560415
1-butyl-3-[2-[2,5-dimethyl-1-(2-thiophen-2-ylethyl)pyrrol-3-yl]-2-oxoethyl]imidazolidine-2,4,5-trione (PubChem CID 16560415) has the molecular formula C21H25N3O4S and a molecular weight of 415.52 g/mol. Its IUPAC name is 1-butyl-3-[2-[2,5-dimethyl-1-(2-thiophen-2-ylethyl)pyrrol-3-yl]-2-oxoethyl]imidazolidine-2,4,5-trione.
| Compound Name | 1-butyl-3-[2-[2,5-dimethyl-1-(2-thiophen-2-ylethyl)pyrrol-3-yl]-2-oxoethyl]imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 16560415 |
| Molecular Formula | C21H25N3O4S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 1-butyl-3-[2-[2,5-dimethyl-1-(2-thiophen-2-ylethyl)pyrrol-3-yl]-2-oxoethyl]imidazolidine-2,4,5-trione |
| SMILES | CCCCN1C(=O)C(=O)N(CC(=O)c2cc(C)n(CCc3cccs3)c2C)C1=O |
| InChI | InChI=1S/C21H25N3O4S/c1-4-5-9-23-19(26)20(27)24(21(23)28)13-18(25)17-12-14(2)22(15(17)3)10-8-16-7-6-11-29-16/h6-7,11-12H,4-5,8-10,13H2,1-3H3 |
| InChIKey | UXFASFZKJDCVBA-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 79.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|