C20H23N3O4S — CID 7681384
1-[2-[2,5-dimethyl-1-(2-thiophen-2-ylethyl)pyrrol-3-yl]-2-oxoethyl]-3-propan-2-ylimidazolidine-2,4,5-trione (PubChem CID 7681384) has the molecular formula C20H23N3O4S and a molecular weight of 401.49 g/mol. Its IUPAC name is 1-[2-[2,5-dimethyl-1-(2-thiophen-2-ylethyl)pyrrol-3-yl]-2-oxoethyl]-3-propan-2-ylimidazolidine-2,4,5-trione.
| Compound Name | 1-[2-[2,5-dimethyl-1-(2-thiophen-2-ylethyl)pyrrol-3-yl]-2-oxoethyl]-3-propan-2-ylimidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 7681384 |
| Molecular Formula | C20H23N3O4S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 1-[2-[2,5-dimethyl-1-(2-thiophen-2-ylethyl)pyrrol-3-yl]-2-oxoethyl]-3-propan-2-ylimidazolidine-2,4,5-trione |
| SMILES | Cc1cc(C(=O)CN2C(=O)C(=O)N(C(C)C)C2=O)c(C)n1CCc1cccs1 |
| InChI | InChI=1S/C20H23N3O4S/c1-12(2)23-19(26)18(25)22(20(23)27)11-17(24)16-10-13(3)21(14(16)4)8-7-15-6-5-9-28-15/h5-6,9-10,12H,7-8,11H2,1-4H3 |
| InChIKey | FOBVLAUDIGDAMU-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 79.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|